C56H49N — CID 167282121
2-[4-[7-(3,5-diphenylphenyl)-10-[4-(6-methylidenecyclohexa-1,3-dien-1-yl)cyclohexen-1-yl]-2,3-dihydroanthracen-9-yl]cyclohexa-1,3-dien-1-yl]-3,4-dihydropyridine (PubChem CID 167282121) has the molecular formula C56H49N and a molecular weight of 736.02 g/mol. Its IUPAC name is 2-[4-[7-(3,5-diphenylphenyl)-10-[4-(6-methylidenecyclohexa-1,3-dien-1-yl)cyclohexen-1-yl]-2,3-dihydroanthracen-9-yl]cyclohexa-1,3-dien-1-yl]-3,4-dihydropyridine.
| Compound Name | 2-[4-[7-(3,5-diphenylphenyl)-10-[4-(6-methylidenecyclohexa-1,3-dien-1-yl)cyclohexen-1-yl]-2,3-dihydroanthracen-9-yl]cyclohexa-1,3-dien-1-yl]-3,4-dihydropyridine |
|---|---|
| PubChem CID | 167282121 |
| Molecular Formula | C56H49N |
| Molecular Weight | 736.02 g/mol |
| Exact Mass | 735.39 |
| IUPAC Name | 2-[4-[7-(3,5-diphenylphenyl)-10-[4-(6-methylidenecyclohexa-1,3-dien-1-yl)cyclohexen-1-yl]-2,3-dihydroanthracen-9-yl]cyclohexa-1,3-dien-1-yl]-3,4-dihydropyridine |
| SMILES | C=C1CC=CC=C1C1CC=C(c2c3c(c(C4=CC=C(C5=NC=CCC5)CC4)c4cc(-c5cc(-c6ccccc6)cc(-c6ccccc6)c5)ccc24)=CCCC=3)CC1 |
| InChI | InChI=1S/C56H49N/c1-38-14-8-9-19-49(38)41-23-27-43(28-24-41)55-50-20-10-11-21-51(50)56(44-29-25-42(26-30-44)54-22-12-13-33-57-54)53-37-45(31-32-52(53)55)48-35-46(39-15-4-2-5-16-39)34-47(36-48)40-17-6-3-7-18-40/h2-9,13,15-21,25,27,29,31-37,41H,1,10-12,14,22-24,26,28,30H2 |
| InChIKey | MEEARFCFMMONHQ-UHFFFAOYSA-N |
| XLogP | 13.67 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 736.02 |
| LogP ≤ 5 | 13.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |