C30H34ClF3N4O4 — CID 146234872
(2,2,2-trifluoroacetyl) 3-(5-tert-butyl-2-chlorophenyl)-4-[1-methyl-5-[2-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)ethoxy]pyrazol-3-yl]butanoate (PubChem CID 146234872) has the molecular formula C30H34ClF3N4O4 and a molecular weight of 607.07 g/mol. Its IUPAC name is (2,2,2-trifluoroacetyl) 3-(5-tert-butyl-2-chlorophenyl)-4-[1-methyl-5-[2-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)ethoxy]pyrazol-3-yl]butanoate.
| Compound Name | (2,2,2-trifluoroacetyl) 3-(5-tert-butyl-2-chlorophenyl)-4-[1-methyl-5-[2-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)ethoxy]pyrazol-3-yl]butanoate |
|---|---|
| PubChem CID | 146234872 |
| Molecular Formula | C30H34ClF3N4O4 |
| Molecular Weight | 607.07 g/mol |
| Exact Mass | 606.22 |
| IUPAC Name | (2,2,2-trifluoroacetyl) 3-(5-tert-butyl-2-chlorophenyl)-4-[1-methyl-5-[2-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)ethoxy]pyrazol-3-yl]butanoate |
| SMILES | Cn1nc(CC(CC(=O)OC(=O)C(F)(F)F)c2cc(C(C)(C)C)ccc2Cl)cc1OCCc1ccc2c(n1)NCCC2 |
| InChI | InChI=1S/C30H34ClF3N4O4/c1-29(2,3)20-8-10-24(31)23(16-20)19(15-26(39)42-28(40)30(32,33)34)14-22-17-25(38(4)37-22)41-13-11-21-9-7-18-6-5-12-35-27(18)36-21/h7-10,16-17,19H,5-6,11-15H2,1-4H3,(H,35,36) |
| InChIKey | NIJLJNLNYFPPCD-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 95.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.07 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|