C28H30N4O5S — CID 146236840
2-[[4-[1-[4-(5-phenyl-1,3,4-oxadiazol-2-yl)phenyl]pentylamino]benzoyl]amino]ethanesulfonic acid (PubChem CID 146236840) has the molecular formula C28H30N4O5S and a molecular weight of 534.64 g/mol. Its IUPAC name is 2-[[4-[1-[4-(5-phenyl-1,3,4-oxadiazol-2-yl)phenyl]pentylamino]benzoyl]amino]ethanesulfonic acid.
| Compound Name | 2-[[4-[1-[4-(5-phenyl-1,3,4-oxadiazol-2-yl)phenyl]pentylamino]benzoyl]amino]ethanesulfonic acid |
|---|---|
| PubChem CID | 146236840 |
| Molecular Formula | C28H30N4O5S |
| Molecular Weight | 534.64 g/mol |
| Exact Mass | 534.19 |
| IUPAC Name | 2-[[4-[1-[4-(5-phenyl-1,3,4-oxadiazol-2-yl)phenyl]pentylamino]benzoyl]amino]ethanesulfonic acid |
| SMILES | CCCCC(Nc1ccc(C(=O)NCCS(=O)(=O)O)cc1)c1ccc(-c2nnc(-c3ccccc3)o2)cc1 |
| InChI | InChI=1S/C28H30N4O5S/c1-2-3-9-25(30-24-16-14-21(15-17-24)26(33)29-18-19-38(34,35)36)20-10-12-23(13-11-20)28-32-31-27(37-28)22-7-5-4-6-8-22/h4-8,10-17,25,30H,2-3,9,18-19H2,1H3,(H,29,33)(H,34,35,36) |
| InChIKey | WQPFWKXBQNNCQZ-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 134.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.64 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|