C31H38N4O4 — CID 166932477
1-ethoxy-3-[[hydroxy-[4-[1-[4-(5-phenyl-1,3,4-oxadiazol-2-yl)phenyl]pentylamino]phenyl]methyl]amino]propan-1-ol (PubChem CID 166932477) has the molecular formula C31H38N4O4 and a molecular weight of 530.67 g/mol. Its IUPAC name is 1-ethoxy-3-[[hydroxy-[4-[1-[4-(5-phenyl-1,3,4-oxadiazol-2-yl)phenyl]pentylamino]phenyl]methyl]amino]propan-1-ol.
| Compound Name | 1-ethoxy-3-[[hydroxy-[4-[1-[4-(5-phenyl-1,3,4-oxadiazol-2-yl)phenyl]pentylamino]phenyl]methyl]amino]propan-1-ol |
|---|---|
| PubChem CID | 166932477 |
| Molecular Formula | C31H38N4O4 |
| Molecular Weight | 530.67 g/mol |
| Exact Mass | 530.29 |
| IUPAC Name | 1-ethoxy-3-[[hydroxy-[4-[1-[4-(5-phenyl-1,3,4-oxadiazol-2-yl)phenyl]pentylamino]phenyl]methyl]amino]propan-1-ol |
| SMILES | CCCCC(Nc1ccc(C(O)NCCC(O)OCC)cc1)c1ccc(-c2nnc(-c3ccccc3)o2)cc1 |
| InChI | InChI=1S/C31H38N4O4/c1-3-5-11-27(33-26-18-16-23(17-19-26)29(37)32-21-20-28(36)38-4-2)22-12-14-25(15-13-22)31-35-34-30(39-31)24-9-7-6-8-10-24/h6-10,12-19,27-29,32-33,36-37H,3-5,11,20-21H2,1-2H3 |
| InChIKey | XQWXAPSEZSPIGO-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 112.67 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.67 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|