C18H17NO4 — CID 146236952
2-(2-hydroxyphenyl)-2-[(2-phenylcyclopropanecarbonyl)amino]acetic acid (PubChem CID 146236952) has the molecular formula C18H17NO4 and a molecular weight of 311.34 g/mol. Its IUPAC name is 2-(2-hydroxyphenyl)-2-[(2-phenylcyclopropanecarbonyl)amino]acetic acid.
| Compound Name | 2-(2-hydroxyphenyl)-2-[(2-phenylcyclopropanecarbonyl)amino]acetic acid |
|---|---|
| PubChem CID | 146236952 |
| Molecular Formula | C18H17NO4 |
| Molecular Weight | 311.34 g/mol |
| Exact Mass | 311.12 |
| IUPAC Name | 2-(2-hydroxyphenyl)-2-[(2-phenylcyclopropanecarbonyl)amino]acetic acid |
| SMILES | O=C(O)C(NC(=O)C1CC1c1ccccc1)c1ccccc1O |
| InChI | InChI=1S/C18H17NO4/c20-15-9-5-4-8-12(15)16(18(22)23)19-17(21)14-10-13(14)11-6-2-1-3-7-11/h1-9,13-14,16,20H,10H2,(H,19,21)(H,22,23) |
| InChIKey | YGYHZASNOSQRIA-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.34 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|