C27H35N3O3 — CID 146239001
ethyl 3-oxo-4-[(1R,5S)-8-(4-prop-1-en-2-ylcyclohexyl)-8-azabicyclo[3.2.1]octan-3-yl]quinoxaline-2-carboxylate (PubChem CID 146239001) has the molecular formula C27H35N3O3 and a molecular weight of 449.60 g/mol. Its IUPAC name is ethyl 3-oxo-4-[(1R,5S)-8-(4-prop-1-en-2-ylcyclohexyl)-8-azabicyclo[3.2.1]octan-3-yl]quinoxaline-2-carboxylate.
| Compound Name | ethyl 3-oxo-4-[(1R,5S)-8-(4-prop-1-en-2-ylcyclohexyl)-8-azabicyclo[3.2.1]octan-3-yl]quinoxaline-2-carboxylate |
|---|---|
| PubChem CID | 146239001 |
| Molecular Formula | C27H35N3O3 |
| Molecular Weight | 449.60 g/mol |
| Exact Mass | 449.27 |
| IUPAC Name | ethyl 3-oxo-4-[(1R,5S)-8-(4-prop-1-en-2-ylcyclohexyl)-8-azabicyclo[3.2.1]octan-3-yl]quinoxaline-2-carboxylate |
| SMILES | C=C(C)C1CCC(N2[C@@H]3CC[C@H]2CC(n2c(=O)c(C(=O)OCC)nc4ccccc42)C3)CC1 |
| InChI | InChI=1S/C27H35N3O3/c1-4-33-27(32)25-26(31)30(24-8-6-5-7-23(24)28-25)22-15-20-13-14-21(16-22)29(20)19-11-9-18(10-12-19)17(2)3/h5-8,18-22H,2,4,9-16H2,1,3H3/t18?,19?,20-,21+,22? |
| InChIKey | MZZWTHQINSSNOL-QMIIDVESSA-N |
| XLogP | 4.88 |
| TPSA | 64.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.60 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|