C26H33N3O3 — CID 59450922
ethyl 4-[(1R,5S)-8-[(2Z)-cyclooct-2-en-1-yl]-8-azabicyclo[3.2.1]octan-3-yl]-3-oxoquinoxaline-2-carboxylate (PubChem CID 59450922) has the molecular formula C26H33N3O3 and a molecular weight of 435.57 g/mol. Its IUPAC name is ethyl 4-[(1R,5S)-8-[(2Z)-cyclooct-2-en-1-yl]-8-azabicyclo[3.2.1]octan-3-yl]-3-oxoquinoxaline-2-carboxylate.
| Compound Name | ethyl 4-[(1R,5S)-8-[(2Z)-cyclooct-2-en-1-yl]-8-azabicyclo[3.2.1]octan-3-yl]-3-oxoquinoxaline-2-carboxylate |
|---|---|
| PubChem CID | 59450922 |
| Molecular Formula | C26H33N3O3 |
| Molecular Weight | 435.57 g/mol |
| Exact Mass | 435.25 |
| IUPAC Name | ethyl 4-[(1R,5S)-8-[(2Z)-cyclooct-2-en-1-yl]-8-azabicyclo[3.2.1]octan-3-yl]-3-oxoquinoxaline-2-carboxylate |
| SMILES | CCOC(=O)c1nc2ccccc2n(C2C[C@H]3CC[C@@H](C2)N3C2/C=C\CCCCC2)c1=O |
| InChI | InChI=1S/C26H33N3O3/c1-2-32-26(31)24-25(30)29(23-13-9-8-12-22(23)27-24)21-16-19-14-15-20(17-21)28(19)18-10-6-4-3-5-7-11-18/h6,8-10,12-13,18-21H,2-5,7,11,14-17H2,1H3/b10-6-/t18?,19-,20+,21? |
| InChIKey | IWZKEJFXBHQFSN-MUIQDXRMSA-N |
| XLogP | 4.63 |
| TPSA | 64.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.57 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|