C23H27N3O2 — CID 118084923
3-acetyl-1-[(1R,5S)-8-cyclohex-2-en-1-yl-8-azabicyclo[3.2.1]octan-3-yl]quinoxalin-2-one (PubChem CID 118084923) has the molecular formula C23H27N3O2 and a molecular weight of 377.49 g/mol. Its IUPAC name is 3-acetyl-1-[(1R,5S)-8-cyclohex-2-en-1-yl-8-azabicyclo[3.2.1]octan-3-yl]quinoxalin-2-one.
| Compound Name | 3-acetyl-1-[(1R,5S)-8-cyclohex-2-en-1-yl-8-azabicyclo[3.2.1]octan-3-yl]quinoxalin-2-one |
|---|---|
| PubChem CID | 118084923 |
| Molecular Formula | C23H27N3O2 |
| Molecular Weight | 377.49 g/mol |
| Exact Mass | 377.21 |
| IUPAC Name | 3-acetyl-1-[(1R,5S)-8-cyclohex-2-en-1-yl-8-azabicyclo[3.2.1]octan-3-yl]quinoxalin-2-one |
| SMILES | CC(=O)c1nc2ccccc2n(C2C[C@H]3CC[C@@H](C2)N3C2C=CCCC2)c1=O |
| InChI | InChI=1S/C23H27N3O2/c1-15(27)22-23(28)26(21-10-6-5-9-20(21)24-22)19-13-17-11-12-18(14-19)25(17)16-7-3-2-4-8-16/h3,5-7,9-10,16-19H,2,4,8,11-14H2,1H3/t16?,17-,18+,19? |
| InChIKey | CGADBKNBJDBURT-FXSDRFNOSA-N |
| XLogP | 3.88 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.49 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|