C7H7N3O2 — CID 146239265
2-amino-4-(1H-imidazol-5-yl)but-3-ynoic acid (PubChem CID 146239265) has the molecular formula C7H7N3O2 and a molecular weight of 165.15 g/mol. Its IUPAC name is 2-amino-4-(1H-imidazol-5-yl)but-3-ynoic acid.
| Compound Name | 2-amino-4-(1H-imidazol-5-yl)but-3-ynoic acid |
|---|---|
| PubChem CID | 146239265 |
| Molecular Formula | C7H7N3O2 |
| Molecular Weight | 165.15 g/mol |
| Exact Mass | 165.05 |
| IUPAC Name | 2-amino-4-(1H-imidazol-5-yl)but-3-ynoic acid |
| SMILES | NC(C#Cc1cnc[nH]1)C(=O)O |
| InChI | InChI=1S/C7H7N3O2/c8-6(7(11)12)2-1-5-3-9-4-10-5/h3-4,6H,8H2,(H,9,10)(H,11,12) |
| InChIKey | XHRYMRHXMHWMAL-UHFFFAOYSA-N |
| XLogP | -0.83 |
| TPSA | 92.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.15 |
| LogP ≤ 5 | -0.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|