(2S)-2,5-diamino-3-(1H-imidazol-5-yl)-4-oxohexanoic acid

C9H14N4O3 — CID 69387162

IUPAC(2S)-2,5-diamino-3-(1H-imidazol-5-yl)-4-oxohexanoic acid
SMILESCC(N)C(=O)C(c1cnc[nH]1)[C@H](N)C(=O)O
InChIInChI=1S/C9H14N4O3/c1-4(10)8(14)6(7(11)9(15)16)5-2-12-3-13-5/h2-4,6-7H,10-11H2,1H3,(H,12,13)(H,15,16)/t4?,6?,7-/m0/s1
InChIKeyIUMDMUUFPQAZJY-QURAEUELSA-N
MW226.24 g/mol
LogP-1.18
Rot. Bonds5

About (2S)-2,5-diamino-3-(1H-imidazol-5-yl)-4-oxohexanoic acid

(2S)-2,5-diamino-3-(1H-imidazol-5-yl)-4-oxohexanoic acid (PubChem CID 69387162) has the molecular formula C9H14N4O3 and a molecular weight of 226.24 g/mol. Its IUPAC name is (2S)-2,5-diamino-3-(1H-imidazol-5-yl)-4-oxohexanoic acid.

Molecular Properties

Compound Name(2S)-2,5-diamino-3-(1H-imidazol-5-yl)-4-oxohexanoic acid
PubChem CID69387162
Molecular FormulaC9H14N4O3
Molecular Weight226.24 g/mol
Exact Mass226.11
IUPAC Name(2S)-2,5-diamino-3-(1H-imidazol-5-yl)-4-oxohexanoic acid
SMILESCC(N)C(=O)C(c1cnc[nH]1)[C@H](N)C(=O)O
InChIInChI=1S/C9H14N4O3/c1-4(10)8(14)6(7(11)9(15)16)5-2-12-3-13-5/h2-4,6-7H,10-11H2,1H3,(H,12,13)(H,15,16)/t4?,6?,7-/m0/s1
InChIKeyIUMDMUUFPQAZJY-QURAEUELSA-N
XLogP-1.18
TPSA135.09 Ų
H-Bond Donors4
H-Bond Acceptors5
Rotatable Bonds5
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500226.24
LogP ≤ 5-1.18
H-Bond Donors ≤ 54
H-Bond Acceptors ≤ 105

Analyze (2S)-2,5-diamino-3-(1H-imidazol-5-yl)-4-oxohexanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2S)-2,5-diamino-3-(1H-imidazol-5-yl)-4-oxohexanoic acid?
The IUPAC name of (2S)-2,5-diamino-3-(1H-imidazol-5-yl)-4-oxohexanoic acid (CID 69387162) is (2S)-2,5-diamino-3-(1H-imidazol-5-yl)-4-oxohexanoic acid.
What is the SMILES notation for (2S)-2,5-diamino-3-(1H-imidazol-5-yl)-4-oxohexanoic acid?
The canonical SMILES for (2S)-2,5-diamino-3-(1H-imidazol-5-yl)-4-oxohexanoic acid is CC(N)C(=O)C(c1cnc[nH]1)[C@H](N)C(=O)O.
What is the InChIKey of (2S)-2,5-diamino-3-(1H-imidazol-5-yl)-4-oxohexanoic acid?
The InChIKey is IUMDMUUFPQAZJY-QURAEUELSA-N. The full InChI is InChI=1S/C9H14N4O3/c1-4(10)8(14)6(7(11)9(15)16)5-2-12-3-13-5/h2-4,6-7H,10-11H2,1H3,(H,12,13)(H,15,16)/t4?,6?,7-/m0/s1.
What are the key properties of (2S)-2,5-diamino-3-(1H-imidazol-5-yl)-4-oxohexanoic acid?
(2S)-2,5-diamino-3-(1H-imidazol-5-yl)-4-oxohexanoic acid has a molecular weight of 226.24 g/mol, XLogP of -1.18, 5 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2,5-diamino-3-(1H-imidazol-5-yl)-4-oxohexanoic acid is sourced from PubChem (CID 69387162), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).