C17H28N4O4 — CID 90422441
5-amino-3-(1H-imidazol-5-yl)-2-(octanoylamino)-4-oxohexanoic acid (PubChem CID 90422441) has the molecular formula C17H28N4O4 and a molecular weight of 352.44 g/mol. Its IUPAC name is 5-amino-3-(1H-imidazol-5-yl)-2-(octanoylamino)-4-oxohexanoic acid.
| Compound Name | 5-amino-3-(1H-imidazol-5-yl)-2-(octanoylamino)-4-oxohexanoic acid |
|---|---|
| PubChem CID | 90422441 |
| Molecular Formula | C17H28N4O4 |
| Molecular Weight | 352.44 g/mol |
| Exact Mass | 352.21 |
| IUPAC Name | 5-amino-3-(1H-imidazol-5-yl)-2-(octanoylamino)-4-oxohexanoic acid |
| SMILES | CCCCCCCC(=O)NC(C(=O)O)C(C(=O)C(C)N)c1cnc[nH]1 |
| InChI | InChI=1S/C17H28N4O4/c1-3-4-5-6-7-8-13(22)21-15(17(24)25)14(16(23)11(2)18)12-9-19-10-20-12/h9-11,14-15H,3-8,18H2,1-2H3,(H,19,20)(H,21,22)(H,24,25) |
| InChIKey | KCBWNGBVWCZQAC-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 138.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.44 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|