carbon dioxide;1-(1H-imidazol-5-yl)ethanamine

C6H9N3O2 — CID 176541381

IUPACcarbon dioxide;1-(1H-imidazol-5-yl)ethanamine
SMILESCC(N)c1cnc[nH]1.O=C=O
InChIInChI=1S/C5H9N3.CO2/c1-4(6)5-2-7-3-8-5;2-1-3/h2-4H,6H2,1H3,(H,7,8);
InChIKeyWJXRMEYUDBCFII-UHFFFAOYSA-N
MW155.16 g/mol
LogP-0.15
Rot. Bonds1

About carbon dioxide;1-(1H-imidazol-5-yl)ethanamine

carbon dioxide;1-(1H-imidazol-5-yl)ethanamine (PubChem CID 176541381) has the molecular formula C6H9N3O2 and a molecular weight of 155.16 g/mol. Its IUPAC name is carbon dioxide;1-(1H-imidazol-5-yl)ethanamine.

Molecular Properties

Compound Namecarbon dioxide;1-(1H-imidazol-5-yl)ethanamine
PubChem CID176541381
Molecular FormulaC6H9N3O2
Molecular Weight155.16 g/mol
Exact Mass155.07
IUPAC Namecarbon dioxide;1-(1H-imidazol-5-yl)ethanamine
SMILESCC(N)c1cnc[nH]1.O=C=O
InChIInChI=1S/C5H9N3.CO2/c1-4(6)5-2-7-3-8-5;2-1-3/h2-4H,6H2,1H3,(H,7,8);
InChIKeyWJXRMEYUDBCFII-UHFFFAOYSA-N
XLogP-0.15
TPSA88.84 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds1
Heavy Atoms11
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500155.16
LogP ≤ 5-0.15
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze carbon dioxide;1-(1H-imidazol-5-yl)ethanamine with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of carbon dioxide;1-(1H-imidazol-5-yl)ethanamine?
The IUPAC name of carbon dioxide;1-(1H-imidazol-5-yl)ethanamine (CID 176541381) is carbon dioxide;1-(1H-imidazol-5-yl)ethanamine.
What is the SMILES notation for carbon dioxide;1-(1H-imidazol-5-yl)ethanamine?
The canonical SMILES for carbon dioxide;1-(1H-imidazol-5-yl)ethanamine is CC(N)c1cnc[nH]1.O=C=O.
What is the InChIKey of carbon dioxide;1-(1H-imidazol-5-yl)ethanamine?
The InChIKey is WJXRMEYUDBCFII-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9N3.CO2/c1-4(6)5-2-7-3-8-5;2-1-3/h2-4H,6H2,1H3,(H,7,8);.
What are the key properties of carbon dioxide;1-(1H-imidazol-5-yl)ethanamine?
carbon dioxide;1-(1H-imidazol-5-yl)ethanamine has a molecular weight of 155.16 g/mol, XLogP of -0.15, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for carbon dioxide;1-(1H-imidazol-5-yl)ethanamine is sourced from PubChem (CID 176541381), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).