C7H13N3 — CID 10447569
(2S,3R)-3-(1H-imidazol-5-yl)butan-2-amine (PubChem CID 10447569) has the molecular formula C7H13N3 and a molecular weight of 139.20 g/mol. Its IUPAC name is (2S,3R)-3-(1H-imidazol-5-yl)butan-2-amine.
| Compound Name | (2S,3R)-3-(1H-imidazol-5-yl)butan-2-amine |
|---|---|
| PubChem CID | 10447569 |
| Molecular Formula | C7H13N3 |
| Molecular Weight | 139.20 g/mol |
| Exact Mass | 139.11 |
| IUPAC Name | (2S,3R)-3-(1H-imidazol-5-yl)butan-2-amine |
| SMILES | C[C@H](N)[C@@H](C)c1cnc[nH]1 |
| InChI | InChI=1S/C7H13N3/c1-5(6(2)8)7-3-9-4-10-7/h3-6H,8H2,1-2H3,(H,9,10)/t5-,6+/m1/s1 |
| InChIKey | QQTWSOMOTYJIQP-RITPCOANSA-N |
| XLogP | 0.86 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 139.20 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |