C24H19F4N2O3S- — CID 146240525
1-[7-[4-fluoro-2-(trifluoromethyl)phenyl]-2-methyl-3-oxo-5H-pyrido[4,3-d][2]benzazepin-10-yl]propane-2-sulfinate (PubChem CID 146240525) has the molecular formula C24H19F4N2O3S- and a molecular weight of 491.49 g/mol. Its IUPAC name is 1-[7-[4-fluoro-2-(trifluoromethyl)phenyl]-2-methyl-3-oxo-5H-pyrido[4,3-d][2]benzazepin-10-yl]propane-2-sulfinate.
| Compound Name | 1-[7-[4-fluoro-2-(trifluoromethyl)phenyl]-2-methyl-3-oxo-5H-pyrido[4,3-d][2]benzazepin-10-yl]propane-2-sulfinate |
|---|---|
| PubChem CID | 146240525 |
| Molecular Formula | C24H19F4N2O3S- |
| Molecular Weight | 491.49 g/mol |
| Exact Mass | 491.11 |
| IUPAC Name | 1-[7-[4-fluoro-2-(trifluoromethyl)phenyl]-2-methyl-3-oxo-5H-pyrido[4,3-d][2]benzazepin-10-yl]propane-2-sulfinate |
| SMILES | CC(Cc1ccc2c(c1)-c1cn(C)c(=O)cc1CN=C2c1ccc(F)cc1C(F)(F)F)S(=O)[O-] |
| InChI | InChI=1S/C24H20F4N2O3S/c1-13(34(32)33)7-14-3-5-17-19(8-14)20-12-30(2)22(31)9-15(20)11-29-23(17)18-6-4-16(25)10-21(18)24(26,27)28/h3-6,8-10,12-13H,7,11H2,1-2H3,(H,32,33)/p-1 |
| InChIKey | AUJMDTIVCRCUGK-UHFFFAOYSA-M |
| XLogP | 4.37 |
| TPSA | 74.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.49 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|