C24H27N3O3 — CID 146240779
[2-(2-cyanophenoxy)-4-phenylcyclopentyl]-[(3R)-piperidin-3-yl]carbamic acid (PubChem CID 146240779) has the molecular formula C24H27N3O3 and a molecular weight of 405.50 g/mol. Its IUPAC name is [2-(2-cyanophenoxy)-4-phenylcyclopentyl]-[(3R)-piperidin-3-yl]carbamic acid.
| Compound Name | [2-(2-cyanophenoxy)-4-phenylcyclopentyl]-[(3R)-piperidin-3-yl]carbamic acid |
|---|---|
| PubChem CID | 146240779 |
| Molecular Formula | C24H27N3O3 |
| Molecular Weight | 405.50 g/mol |
| Exact Mass | 405.21 |
| IUPAC Name | [2-(2-cyanophenoxy)-4-phenylcyclopentyl]-[(3R)-piperidin-3-yl]carbamic acid |
| SMILES | N#Cc1ccccc1OC1CC(c2ccccc2)CC1N(C(=O)O)[C@@H]1CCCNC1 |
| InChI | InChI=1S/C24H27N3O3/c25-15-18-9-4-5-11-22(18)30-23-14-19(17-7-2-1-3-8-17)13-21(23)27(24(28)29)20-10-6-12-26-16-20/h1-5,7-9,11,19-21,23,26H,6,10,12-14,16H2,(H,28,29)/t19?,20-,21?,23?/m1/s1 |
| InChIKey | LGNGOFMSLPBQLS-USFSBILMSA-N |
| XLogP | 3.98 |
| TPSA | 85.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.50 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |