C25H28FN3O4 — CID 146240953
piperidin-3-yl N-[2-(4-cyanophenoxy)-4-(4-fluoro-3-methoxyphenyl)cyclopentyl]carbamate (PubChem CID 146240953) has the molecular formula C25H28FN3O4 and a molecular weight of 453.51 g/mol. Its IUPAC name is piperidin-3-yl N-[2-(4-cyanophenoxy)-4-(4-fluoro-3-methoxyphenyl)cyclopentyl]carbamate.
| Compound Name | piperidin-3-yl N-[2-(4-cyanophenoxy)-4-(4-fluoro-3-methoxyphenyl)cyclopentyl]carbamate |
|---|---|
| PubChem CID | 146240953 |
| Molecular Formula | C25H28FN3O4 |
| Molecular Weight | 453.51 g/mol |
| Exact Mass | 453.21 |
| IUPAC Name | piperidin-3-yl N-[2-(4-cyanophenoxy)-4-(4-fluoro-3-methoxyphenyl)cyclopentyl]carbamate |
| SMILES | COc1cc(C2CC(NC(=O)OC3CCCNC3)C(Oc3ccc(C#N)cc3)C2)ccc1F |
| InChI | InChI=1S/C25H28FN3O4/c1-31-23-12-17(6-9-21(23)26)18-11-22(29-25(30)33-20-3-2-10-28-15-20)24(13-18)32-19-7-4-16(14-27)5-8-19/h4-9,12,18,20,22,24,28H,2-3,10-11,13,15H2,1H3,(H,29,30) |
| InChIKey | OKFSDRFENTYIBA-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 92.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.51 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |