C18H25NO9 — CID 18448506
(2S,3S)-2,3-dihydroxybutanedioic acid;methyl 2-methoxy-5-piperidin-3-ylbenzoate (PubChem CID 18448506) has the molecular formula C18H25NO9 and a molecular weight of 399.40 g/mol. Its IUPAC name is (2S,3S)-2,3-dihydroxybutanedioic acid;methyl 2-methoxy-5-piperidin-3-ylbenzoate.
| Compound Name | (2S,3S)-2,3-dihydroxybutanedioic acid;methyl 2-methoxy-5-piperidin-3-ylbenzoate |
|---|---|
| PubChem CID | 18448506 |
| Molecular Formula | C18H25NO9 |
| Molecular Weight | 399.40 g/mol |
| Exact Mass | 399.15 |
| IUPAC Name | (2S,3S)-2,3-dihydroxybutanedioic acid;methyl 2-methoxy-5-piperidin-3-ylbenzoate |
| SMILES | COC(=O)c1cc(C2CCCNC2)ccc1OC.O=C(O)[C@@H](O)[C@H](O)C(=O)O |
| InChI | InChI=1S/C14H19NO3.C4H6O6/c1-17-13-6-5-10(8-12(13)14(16)18-2)11-4-3-7-15-9-11;5-1(3(7)8)2(6)4(9)10/h5-6,8,11,15H,3-4,7,9H2,1-2H3;1-2,5-6H,(H,7,8)(H,9,10)/t;1-,2-/m.0/s1 |
| InChIKey | IONZQMRKEOJGGP-WUUYCOTASA-N |
| XLogP | -0.17 |
| TPSA | 162.62 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.40 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |