C26H29Cl2NO4S — CID 146240839
3,4-bis[2-chloro-2-(2-ethoxyphenyl)ethyl]benzenesulfonamide (PubChem CID 146240839) has the molecular formula C26H29Cl2NO4S and a molecular weight of 522.49 g/mol. Its IUPAC name is 3,4-bis[2-chloro-2-(2-ethoxyphenyl)ethyl]benzenesulfonamide.
| Compound Name | 3,4-bis[2-chloro-2-(2-ethoxyphenyl)ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 146240839 |
| Molecular Formula | C26H29Cl2NO4S |
| Molecular Weight | 522.49 g/mol |
| Exact Mass | 521.12 |
| IUPAC Name | 3,4-bis[2-chloro-2-(2-ethoxyphenyl)ethyl]benzenesulfonamide |
| SMILES | CCOc1ccccc1C(Cl)Cc1ccc(S(N)(=O)=O)cc1CC(Cl)c1ccccc1OCC |
| InChI | InChI=1S/C26H29Cl2NO4S/c1-3-32-25-11-7-5-9-21(25)23(27)16-18-13-14-20(34(29,30)31)15-19(18)17-24(28)22-10-6-8-12-26(22)33-4-2/h5-15,23-24H,3-4,16-17H2,1-2H3,(H2,29,30,31) |
| InChIKey | WHTKJUFLBFHQPQ-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.49 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|