C19H24F2N4 — CID 146241025
1-[2-fluoro-3-(4-fluorophenyl)-5-pyrazol-1-ylcyclopentyl]piperidin-3-amine (PubChem CID 146241025) has the molecular formula C19H24F2N4 and a molecular weight of 346.43 g/mol. Its IUPAC name is 1-[2-fluoro-3-(4-fluorophenyl)-5-pyrazol-1-ylcyclopentyl]piperidin-3-amine.
| Compound Name | 1-[2-fluoro-3-(4-fluorophenyl)-5-pyrazol-1-ylcyclopentyl]piperidin-3-amine |
|---|---|
| PubChem CID | 146241025 |
| Molecular Formula | C19H24F2N4 |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.20 |
| IUPAC Name | 1-[2-fluoro-3-(4-fluorophenyl)-5-pyrazol-1-ylcyclopentyl]piperidin-3-amine |
| SMILES | NC1CCCN(C2C(F)C(c3ccc(F)cc3)CC2n2cccn2)C1 |
| InChI | InChI=1S/C19H24F2N4/c20-14-6-4-13(5-7-14)16-11-17(25-10-2-8-23-25)19(18(16)21)24-9-1-3-15(22)12-24/h2,4-8,10,15-19H,1,3,9,11-12,22H2 |
| InChIKey | APPTYNZVIBLGLF-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 47.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |