C14H26O4 — CID 146242205
ethyl 3,12-dihydroxydodec-2-enoate (PubChem CID 146242205) has the molecular formula C14H26O4 and a molecular weight of 258.36 g/mol. Its IUPAC name is ethyl 3,12-dihydroxydodec-2-enoate.
| Compound Name | ethyl 3,12-dihydroxydodec-2-enoate |
|---|---|
| PubChem CID | 146242205 |
| Molecular Formula | C14H26O4 |
| Molecular Weight | 258.36 g/mol |
| Exact Mass | 258.18 |
| IUPAC Name | ethyl 3,12-dihydroxydodec-2-enoate |
| SMILES | CCOC(=O)C=C(O)CCCCCCCCCO |
| InChI | InChI=1S/C14H26O4/c1-2-18-14(17)12-13(16)10-8-6-4-3-5-7-9-11-15/h12,15-16H,2-11H2,1H3 |
| InChIKey | JNPQKGQBGSBZCT-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.36 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|