C19H19N3O6S — CID 146242953
(E)-3-[4-(4-methylsulfonylphenyl)-6-(2-oxa-6-azaspiro[3.3]heptan-6-yl)-5-oxopyrazin-2-yl]prop-2-enoic acid (PubChem CID 146242953) has the molecular formula C19H19N3O6S and a molecular weight of 417.44 g/mol. Its IUPAC name is (E)-3-[4-(4-methylsulfonylphenyl)-6-(2-oxa-6-azaspiro[3.3]heptan-6-yl)-5-oxopyrazin-2-yl]prop-2-enoic acid.
| Compound Name | (E)-3-[4-(4-methylsulfonylphenyl)-6-(2-oxa-6-azaspiro[3.3]heptan-6-yl)-5-oxopyrazin-2-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 146242953 |
| Molecular Formula | C19H19N3O6S |
| Molecular Weight | 417.44 g/mol |
| Exact Mass | 417.10 |
| IUPAC Name | (E)-3-[4-(4-methylsulfonylphenyl)-6-(2-oxa-6-azaspiro[3.3]heptan-6-yl)-5-oxopyrazin-2-yl]prop-2-enoic acid |
| SMILES | CS(=O)(=O)c1ccc(-n2cc(/C=C/C(=O)O)nc(N3CC4(COC4)C3)c2=O)cc1 |
| InChI | InChI=1S/C19H19N3O6S/c1-29(26,27)15-5-3-14(4-6-15)22-8-13(2-7-16(23)24)20-17(18(22)25)21-9-19(10-21)11-28-12-19/h2-8H,9-12H2,1H3,(H,23,24)/b7-2+ |
| InChIKey | DMNPNWFIPOWWKG-FARCUNLSSA-N |
| XLogP | 0.57 |
| TPSA | 118.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.44 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|