C20H23N3O6S — CID 146252071
ethyl (E)-3-[4-(4-methylsulfonylphenyl)-6-morpholin-4-yl-5-oxopyrazin-2-yl]prop-2-enoate (PubChem CID 146252071) has the molecular formula C20H23N3O6S and a molecular weight of 433.49 g/mol. Its IUPAC name is ethyl (E)-3-[4-(4-methylsulfonylphenyl)-6-morpholin-4-yl-5-oxopyrazin-2-yl]prop-2-enoate.
| Compound Name | ethyl (E)-3-[4-(4-methylsulfonylphenyl)-6-morpholin-4-yl-5-oxopyrazin-2-yl]prop-2-enoate |
|---|---|
| PubChem CID | 146252071 |
| Molecular Formula | C20H23N3O6S |
| Molecular Weight | 433.49 g/mol |
| Exact Mass | 433.13 |
| IUPAC Name | ethyl (E)-3-[4-(4-methylsulfonylphenyl)-6-morpholin-4-yl-5-oxopyrazin-2-yl]prop-2-enoate |
| SMILES | CCOC(=O)/C=C/c1cn(-c2ccc(S(C)(=O)=O)cc2)c(=O)c(N2CCOCC2)n1 |
| InChI | InChI=1S/C20H23N3O6S/c1-3-29-18(24)9-4-15-14-23(16-5-7-17(8-6-16)30(2,26)27)20(25)19(21-15)22-10-12-28-13-11-22/h4-9,14H,3,10-13H2,1-2H3/b9-4+ |
| InChIKey | OZERGGXBDDFYIL-RUDMXATFSA-N |
| XLogP | 1.05 |
| TPSA | 107.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.49 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|