C18H21N3O5S — CID 146251923
3-[4-(4-methylsulfonylphenyl)-6-morpholin-4-yl-5-oxopyrazin-2-yl]propanal (PubChem CID 146251923) has the molecular formula C18H21N3O5S and a molecular weight of 391.45 g/mol. Its IUPAC name is 3-[4-(4-methylsulfonylphenyl)-6-morpholin-4-yl-5-oxopyrazin-2-yl]propanal.
| Compound Name | 3-[4-(4-methylsulfonylphenyl)-6-morpholin-4-yl-5-oxopyrazin-2-yl]propanal |
|---|---|
| PubChem CID | 146251923 |
| Molecular Formula | C18H21N3O5S |
| Molecular Weight | 391.45 g/mol |
| Exact Mass | 391.12 |
| IUPAC Name | 3-[4-(4-methylsulfonylphenyl)-6-morpholin-4-yl-5-oxopyrazin-2-yl]propanal |
| SMILES | CS(=O)(=O)c1ccc(-n2cc(CCC=O)nc(N3CCOCC3)c2=O)cc1 |
| InChI | InChI=1S/C18H21N3O5S/c1-27(24,25)16-6-4-15(5-7-16)21-13-14(3-2-10-22)19-17(18(21)23)20-8-11-26-12-9-20/h4-7,10,13H,2-3,8-9,11-12H2,1H3 |
| InChIKey | JZMFMEZTMDNBDN-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 98.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.45 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|