C24H33N5O6S — CID 146251935
tert-butyl 4-[4-[4-(dimethylsulfamoyl)phenyl]-3-oxo-6-(3-oxopropyl)pyrazin-2-yl]piperazine-1-carboxylate (PubChem CID 146251935) has the molecular formula C24H33N5O6S and a molecular weight of 519.62 g/mol. Its IUPAC name is tert-butyl 4-[4-[4-(dimethylsulfamoyl)phenyl]-3-oxo-6-(3-oxopropyl)pyrazin-2-yl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[4-[4-(dimethylsulfamoyl)phenyl]-3-oxo-6-(3-oxopropyl)pyrazin-2-yl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 146251935 |
| Molecular Formula | C24H33N5O6S |
| Molecular Weight | 519.62 g/mol |
| Exact Mass | 519.22 |
| IUPAC Name | tert-butyl 4-[4-[4-(dimethylsulfamoyl)phenyl]-3-oxo-6-(3-oxopropyl)pyrazin-2-yl]piperazine-1-carboxylate |
| SMILES | CN(C)S(=O)(=O)c1ccc(-n2cc(CCC=O)nc(N3CCN(C(=O)OC(C)(C)C)CC3)c2=O)cc1 |
| InChI | InChI=1S/C24H33N5O6S/c1-24(2,3)35-23(32)28-14-12-27(13-15-28)21-22(31)29(17-18(25-21)7-6-16-30)19-8-10-20(11-9-19)36(33,34)26(4)5/h8-11,16-17H,6-7,12-15H2,1-5H3 |
| InChIKey | GIOUSCWIAXFNMR-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 122.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.62 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|