C18H21FN4O4S — CID 146242973
3-[4-(4-fluorophenyl)-6-(4-methylsulfonylpiperazin-1-yl)-5-oxopyrazin-2-yl]propanal (PubChem CID 146242973) has the molecular formula C18H21FN4O4S and a molecular weight of 408.46 g/mol. Its IUPAC name is 3-[4-(4-fluorophenyl)-6-(4-methylsulfonylpiperazin-1-yl)-5-oxopyrazin-2-yl]propanal.
| Compound Name | 3-[4-(4-fluorophenyl)-6-(4-methylsulfonylpiperazin-1-yl)-5-oxopyrazin-2-yl]propanal |
|---|---|
| PubChem CID | 146242973 |
| Molecular Formula | C18H21FN4O4S |
| Molecular Weight | 408.46 g/mol |
| Exact Mass | 408.13 |
| IUPAC Name | 3-[4-(4-fluorophenyl)-6-(4-methylsulfonylpiperazin-1-yl)-5-oxopyrazin-2-yl]propanal |
| SMILES | CS(=O)(=O)N1CCN(c2nc(CCC=O)cn(-c3ccc(F)cc3)c2=O)CC1 |
| InChI | InChI=1S/C18H21FN4O4S/c1-28(26,27)22-10-8-21(9-11-22)17-18(25)23(13-15(20-17)3-2-12-24)16-6-4-14(19)5-7-16/h4-7,12-13H,2-3,8-11H2,1H3 |
| InChIKey | JRIQEFSZMLUMQX-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 92.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.46 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|