C18H23FN4O4S — CID 146243005
1-(4-fluorophenyl)-5-(3-hydroxypropyl)-3-(4-methylsulfonylpiperazin-1-yl)pyrazin-2-one (PubChem CID 146243005) has the molecular formula C18H23FN4O4S and a molecular weight of 410.47 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-5-(3-hydroxypropyl)-3-(4-methylsulfonylpiperazin-1-yl)pyrazin-2-one.
| Compound Name | 1-(4-fluorophenyl)-5-(3-hydroxypropyl)-3-(4-methylsulfonylpiperazin-1-yl)pyrazin-2-one |
|---|---|
| PubChem CID | 146243005 |
| Molecular Formula | C18H23FN4O4S |
| Molecular Weight | 410.47 g/mol |
| Exact Mass | 410.14 |
| IUPAC Name | 1-(4-fluorophenyl)-5-(3-hydroxypropyl)-3-(4-methylsulfonylpiperazin-1-yl)pyrazin-2-one |
| SMILES | CS(=O)(=O)N1CCN(c2nc(CCCO)cn(-c3ccc(F)cc3)c2=O)CC1 |
| InChI | InChI=1S/C18H23FN4O4S/c1-28(26,27)22-10-8-21(9-11-22)17-18(25)23(13-15(20-17)3-2-12-24)16-6-4-14(19)5-7-16/h4-7,13,24H,2-3,8-12H2,1H3 |
| InChIKey | UIJDTPCECNRELW-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 95.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.47 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |