C19H26FN5OS — CID 146252129
1-(4-fluorophenyl)-5-[3-(methylamino)propyl]-3-(4-methylsulfanylpiperazin-1-yl)pyrazin-2-one (PubChem CID 146252129) has the molecular formula C19H26FN5OS and a molecular weight of 391.52 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-5-[3-(methylamino)propyl]-3-(4-methylsulfanylpiperazin-1-yl)pyrazin-2-one.
| Compound Name | 1-(4-fluorophenyl)-5-[3-(methylamino)propyl]-3-(4-methylsulfanylpiperazin-1-yl)pyrazin-2-one |
|---|---|
| PubChem CID | 146252129 |
| Molecular Formula | C19H26FN5OS |
| Molecular Weight | 391.52 g/mol |
| Exact Mass | 391.18 |
| IUPAC Name | 1-(4-fluorophenyl)-5-[3-(methylamino)propyl]-3-(4-methylsulfanylpiperazin-1-yl)pyrazin-2-one |
| SMILES | CNCCCc1cn(-c2ccc(F)cc2)c(=O)c(N2CCN(SC)CC2)n1 |
| InChI | InChI=1S/C19H26FN5OS/c1-21-9-3-4-16-14-25(17-7-5-15(20)6-8-17)19(26)18(22-16)23-10-12-24(27-2)13-11-23/h5-8,14,21H,3-4,9-13H2,1-2H3 |
| InChIKey | CRXIOWJLQCFAHJ-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 53.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.52 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|