C17H20FN3O3 — CID 146251809
1-(4-fluorophenyl)-5-(3-hydroxypropyl)-3-morpholin-4-ylpyrazin-2-one (PubChem CID 146251809) has the molecular formula C17H20FN3O3 and a molecular weight of 333.36 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-5-(3-hydroxypropyl)-3-morpholin-4-ylpyrazin-2-one.
| Compound Name | 1-(4-fluorophenyl)-5-(3-hydroxypropyl)-3-morpholin-4-ylpyrazin-2-one |
|---|---|
| PubChem CID | 146251809 |
| Molecular Formula | C17H20FN3O3 |
| Molecular Weight | 333.36 g/mol |
| Exact Mass | 333.15 |
| IUPAC Name | 1-(4-fluorophenyl)-5-(3-hydroxypropyl)-3-morpholin-4-ylpyrazin-2-one |
| SMILES | O=c1c(N2CCOCC2)nc(CCCO)cn1-c1ccc(F)cc1 |
| InChI | InChI=1S/C17H20FN3O3/c18-13-3-5-15(6-4-13)21-12-14(2-1-9-22)19-16(17(21)23)20-7-10-24-11-8-20/h3-6,12,22H,1-2,7-11H2 |
| InChIKey | GLWSAXPJZZUWBI-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.36 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |