C18H22FN3O2 — CID 146243096
1-(4-fluorophenyl)-5-(3-hydroxypropyl)-3-piperidin-1-ylpyrazin-2-one (PubChem CID 146243096) has the molecular formula C18H22FN3O2 and a molecular weight of 331.39 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-5-(3-hydroxypropyl)-3-piperidin-1-ylpyrazin-2-one.
| Compound Name | 1-(4-fluorophenyl)-5-(3-hydroxypropyl)-3-piperidin-1-ylpyrazin-2-one |
|---|---|
| PubChem CID | 146243096 |
| Molecular Formula | C18H22FN3O2 |
| Molecular Weight | 331.39 g/mol |
| Exact Mass | 331.17 |
| IUPAC Name | 1-(4-fluorophenyl)-5-(3-hydroxypropyl)-3-piperidin-1-ylpyrazin-2-one |
| SMILES | O=c1c(N2CCCCC2)nc(CCCO)cn1-c1ccc(F)cc1 |
| InChI | InChI=1S/C18H22FN3O2/c19-14-6-8-16(9-7-14)22-13-15(5-4-12-23)20-17(18(22)24)21-10-2-1-3-11-21/h6-9,13,23H,1-5,10-12H2 |
| InChIKey | VDFYFCHNMYAFEE-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.39 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |