C20H27N5O4S — CID 146243050
N,N-dimethyl-4-[3-(4-methylpiperazin-1-yl)-2-oxo-5-(3-oxopropyl)pyrazin-1-yl]benzenesulfonamide (PubChem CID 146243050) has the molecular formula C20H27N5O4S and a molecular weight of 433.53 g/mol. Its IUPAC name is N,N-dimethyl-4-[3-(4-methylpiperazin-1-yl)-2-oxo-5-(3-oxopropyl)pyrazin-1-yl]benzenesulfonamide.
| Compound Name | N,N-dimethyl-4-[3-(4-methylpiperazin-1-yl)-2-oxo-5-(3-oxopropyl)pyrazin-1-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 146243050 |
| Molecular Formula | C20H27N5O4S |
| Molecular Weight | 433.53 g/mol |
| Exact Mass | 433.18 |
| IUPAC Name | N,N-dimethyl-4-[3-(4-methylpiperazin-1-yl)-2-oxo-5-(3-oxopropyl)pyrazin-1-yl]benzenesulfonamide |
| SMILES | CN1CCN(c2nc(CCC=O)cn(-c3ccc(S(=O)(=O)N(C)C)cc3)c2=O)CC1 |
| InChI | InChI=1S/C20H27N5O4S/c1-22(2)30(28,29)18-8-6-17(7-9-18)25-15-16(5-4-14-26)21-19(20(25)27)24-12-10-23(3)11-13-24/h6-9,14-15H,4-5,10-13H2,1-3H3 |
| InChIKey | SVHSIJFXWGDFQC-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 95.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.53 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|