C18H21FN4O2S — CID 153363078
3-[4-(4-fluorophenyl)-6-(4-methylsulfanylpiperazin-1-yl)-5-oxopyrazin-2-yl]propanal (PubChem CID 153363078) has the molecular formula C18H21FN4O2S and a molecular weight of 376.46 g/mol. Its IUPAC name is 3-[4-(4-fluorophenyl)-6-(4-methylsulfanylpiperazin-1-yl)-5-oxopyrazin-2-yl]propanal.
| Compound Name | 3-[4-(4-fluorophenyl)-6-(4-methylsulfanylpiperazin-1-yl)-5-oxopyrazin-2-yl]propanal |
|---|---|
| PubChem CID | 153363078 |
| Molecular Formula | C18H21FN4O2S |
| Molecular Weight | 376.46 g/mol |
| Exact Mass | 376.14 |
| IUPAC Name | 3-[4-(4-fluorophenyl)-6-(4-methylsulfanylpiperazin-1-yl)-5-oxopyrazin-2-yl]propanal |
| SMILES | CSN1CCN(c2nc(CCC=O)cn(-c3ccc(F)cc3)c2=O)CC1 |
| InChI | InChI=1S/C18H21FN4O2S/c1-26-22-10-8-21(9-11-22)17-18(25)23(13-15(20-17)3-2-12-24)16-6-4-14(19)5-7-16/h4-7,12-13H,2-3,8-11H2,1H3 |
| InChIKey | ZISALUQAJYGIBD-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 58.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.46 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|