C18H23N3O5S — CID 146251918
5-(3-hydroxypropyl)-1-(4-methylsulfonylphenyl)-3-morpholin-4-ylpyrazin-2-one (PubChem CID 146251918) has the molecular formula C18H23N3O5S and a molecular weight of 393.47 g/mol. Its IUPAC name is 5-(3-hydroxypropyl)-1-(4-methylsulfonylphenyl)-3-morpholin-4-ylpyrazin-2-one.
| Compound Name | 5-(3-hydroxypropyl)-1-(4-methylsulfonylphenyl)-3-morpholin-4-ylpyrazin-2-one |
|---|---|
| PubChem CID | 146251918 |
| Molecular Formula | C18H23N3O5S |
| Molecular Weight | 393.47 g/mol |
| Exact Mass | 393.14 |
| IUPAC Name | 5-(3-hydroxypropyl)-1-(4-methylsulfonylphenyl)-3-morpholin-4-ylpyrazin-2-one |
| SMILES | CS(=O)(=O)c1ccc(-n2cc(CCCO)nc(N3CCOCC3)c2=O)cc1 |
| InChI | InChI=1S/C18H23N3O5S/c1-27(24,25)16-6-4-15(5-7-16)21-13-14(3-2-10-22)19-17(18(21)23)20-8-11-26-12-9-20/h4-7,13,22H,2-3,8-12H2,1H3 |
| InChIKey | LHKVSALSASLJAA-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 101.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.47 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |