C21H26FN5O2 — CID 146242955
5-[3-[[(1R,2S)-2-(4-fluorophenyl)cyclopropyl]amino]propyl]-3-(4-methyl-3-oxopiperazin-1-yl)-1H-pyrazin-2-one (PubChem CID 146242955) has the molecular formula C21H26FN5O2 and a molecular weight of 399.47 g/mol. Its IUPAC name is 5-[3-[[(1R,2S)-2-(4-fluorophenyl)cyclopropyl]amino]propyl]-3-(4-methyl-3-oxopiperazin-1-yl)-1H-pyrazin-2-one.
| Compound Name | 5-[3-[[(1R,2S)-2-(4-fluorophenyl)cyclopropyl]amino]propyl]-3-(4-methyl-3-oxopiperazin-1-yl)-1H-pyrazin-2-one |
|---|---|
| PubChem CID | 146242955 |
| Molecular Formula | C21H26FN5O2 |
| Molecular Weight | 399.47 g/mol |
| Exact Mass | 399.21 |
| IUPAC Name | 5-[3-[[(1R,2S)-2-(4-fluorophenyl)cyclopropyl]amino]propyl]-3-(4-methyl-3-oxopiperazin-1-yl)-1H-pyrazin-2-one |
| SMILES | CN1CCN(c2nc(CCCN[C@@H]3C[C@H]3c3ccc(F)cc3)c[nH]c2=O)CC1=O |
| InChI | InChI=1S/C21H26FN5O2/c1-26-9-10-27(13-19(26)28)20-21(29)24-12-16(25-20)3-2-8-23-18-11-17(18)14-4-6-15(22)7-5-14/h4-7,12,17-18,23H,2-3,8-11,13H2,1H3,(H,24,29)/t17-,18+/m0/s1 |
| InChIKey | OVTSUIDSLHGYIO-ZWKOTPCHSA-N |
| XLogP | 1.27 |
| TPSA | 81.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.47 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|