C18H23F2N7O3 — CID 18671904
N-[2-(diaminomethylideneamino)oxyethyl]-2-[3-[2-(3,4-difluorophenyl)ethylamino]-6-methyl-2-oxopyrazin-1-yl]acetamide (PubChem CID 18671904) has the molecular formula C18H23F2N7O3 and a molecular weight of 423.42 g/mol. Its IUPAC name is N-[2-(diaminomethylideneamino)oxyethyl]-2-[3-[2-(3,4-difluorophenyl)ethylamino]-6-methyl-2-oxopyrazin-1-yl]acetamide.
| Compound Name | N-[2-(diaminomethylideneamino)oxyethyl]-2-[3-[2-(3,4-difluorophenyl)ethylamino]-6-methyl-2-oxopyrazin-1-yl]acetamide |
|---|---|
| PubChem CID | 18671904 |
| Molecular Formula | C18H23F2N7O3 |
| Molecular Weight | 423.42 g/mol |
| Exact Mass | 423.18 |
| IUPAC Name | N-[2-(diaminomethylideneamino)oxyethyl]-2-[3-[2-(3,4-difluorophenyl)ethylamino]-6-methyl-2-oxopyrazin-1-yl]acetamide |
| SMILES | Cc1cnc(NCCc2ccc(F)c(F)c2)c(=O)n1CC(=O)NCCON=C(N)N |
| InChI | InChI=1S/C18H23F2N7O3/c1-11-9-25-16(24-5-4-12-2-3-13(19)14(20)8-12)17(29)27(11)10-15(28)23-6-7-30-26-18(21)22/h2-3,8-9H,4-7,10H2,1H3,(H,23,28)(H,24,25)(H4,21,22,26) |
| InChIKey | MPAHBYSEQCNGJR-UHFFFAOYSA-N |
| XLogP | -0.19 |
| TPSA | 149.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.42 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|