C21H27FN4O — CID 146243011
5-[3-[[(1R,2S)-2-(4-fluorophenyl)cyclopropyl]amino]propyl]-3-piperidin-1-yl-1H-pyrazin-2-one (PubChem CID 146243011) has the molecular formula C21H27FN4O and a molecular weight of 370.47 g/mol. Its IUPAC name is 5-[3-[[(1R,2S)-2-(4-fluorophenyl)cyclopropyl]amino]propyl]-3-piperidin-1-yl-1H-pyrazin-2-one.
| Compound Name | 5-[3-[[(1R,2S)-2-(4-fluorophenyl)cyclopropyl]amino]propyl]-3-piperidin-1-yl-1H-pyrazin-2-one |
|---|---|
| PubChem CID | 146243011 |
| Molecular Formula | C21H27FN4O |
| Molecular Weight | 370.47 g/mol |
| Exact Mass | 370.22 |
| IUPAC Name | 5-[3-[[(1R,2S)-2-(4-fluorophenyl)cyclopropyl]amino]propyl]-3-piperidin-1-yl-1H-pyrazin-2-one |
| SMILES | O=c1[nH]cc(CCCN[C@@H]2C[C@H]2c2ccc(F)cc2)nc1N1CCCCC1 |
| InChI | InChI=1S/C21H27FN4O/c22-16-8-6-15(7-9-16)18-13-19(18)23-10-4-5-17-14-24-21(27)20(25-17)26-11-2-1-3-12-26/h6-9,14,18-19,23H,1-5,10-13H2,(H,24,27)/t18-,19+/m0/s1 |
| InChIKey | LWKZYSUVIUNNER-RBUKOAKNSA-N |
| XLogP | 2.98 |
| TPSA | 61.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.47 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|