C19H23FN4O2 — CID 146243028
3-[4-[(4-fluorophenyl)methyl]-6-(4-methylpiperazin-1-yl)-5-oxopyrazin-2-yl]propanal (PubChem CID 146243028) has the molecular formula C19H23FN4O2 and a molecular weight of 358.42 g/mol. Its IUPAC name is 3-[4-[(4-fluorophenyl)methyl]-6-(4-methylpiperazin-1-yl)-5-oxopyrazin-2-yl]propanal.
| Compound Name | 3-[4-[(4-fluorophenyl)methyl]-6-(4-methylpiperazin-1-yl)-5-oxopyrazin-2-yl]propanal |
|---|---|
| PubChem CID | 146243028 |
| Molecular Formula | C19H23FN4O2 |
| Molecular Weight | 358.42 g/mol |
| Exact Mass | 358.18 |
| IUPAC Name | 3-[4-[(4-fluorophenyl)methyl]-6-(4-methylpiperazin-1-yl)-5-oxopyrazin-2-yl]propanal |
| SMILES | CN1CCN(c2nc(CCC=O)cn(Cc3ccc(F)cc3)c2=O)CC1 |
| InChI | InChI=1S/C19H23FN4O2/c1-22-8-10-23(11-9-22)18-19(26)24(14-17(21-18)3-2-12-25)13-15-4-6-16(20)7-5-15/h4-7,12,14H,2-3,8-11,13H2,1H3 |
| InChIKey | FNHNOSKQIBJFKR-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 58.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.42 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|