C11H24Cl2N2O2 — CID 146243673
ethyl 3-(2,2-dimethylpiperazin-1-yl)propanoate;dihydrochloride (PubChem CID 146243673) has the molecular formula C11H24Cl2N2O2 and a molecular weight of 287.23 g/mol. Its IUPAC name is ethyl 3-(2,2-dimethylpiperazin-1-yl)propanoate;dihydrochloride.
| Compound Name | ethyl 3-(2,2-dimethylpiperazin-1-yl)propanoate;dihydrochloride |
|---|---|
| PubChem CID | 146243673 |
| Molecular Formula | C11H24Cl2N2O2 |
| Molecular Weight | 287.23 g/mol |
| Exact Mass | 286.12 |
| IUPAC Name | ethyl 3-(2,2-dimethylpiperazin-1-yl)propanoate;dihydrochloride |
| SMILES | CCOC(=O)CCN1CCNCC1(C)C.Cl.Cl |
| InChI | InChI=1S/C11H22N2O2.2ClH/c1-4-15-10(14)5-7-13-8-6-12-9-11(13,2)3;;/h12H,4-9H2,1-3H3;2*1H |
| InChIKey | DKDDJRRSEOPJKI-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.23 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |