About N-carbamoyl-2-(2,2-dimethylpiperazin-1-yl)acetamide
N-carbamoyl-2-(2,2-dimethylpiperazin-1-yl)acetamide (PubChem CID 65463600) has the molecular formula C9H18N4O2
and a molecular weight of 214.27 g/mol. Its IUPAC name is N-carbamoyl-2-(2,2-dimethylpiperazin-1-yl)acetamide.
Molecular Properties
| Compound Name | N-carbamoyl-2-(2,2-dimethylpiperazin-1-yl)acetamide |
| PubChem CID | 65463600 |
| Molecular Formula | C9H18N4O2 |
| Molecular Weight | 214.27 g/mol |
| Exact Mass | 214.14 |
| IUPAC Name | N-carbamoyl-2-(2,2-dimethylpiperazin-1-yl)acetamide |
| SMILES | CC1(C)CNCCN1CC(=O)NC(N)=O |
| InChI | InChI=1S/C9H18N4O2/c1-9(2)6-11-3-4-13(9)5-7(14)12-8(10)15/h11H,3-6H2,1-2H3,(H3,10,12,14,15) |
| InChIKey | DMBIJNRKGPKOGW-UHFFFAOYSA-N |
| XLogP | -1.13 |
| TPSA | 87.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.27 |
| LogP ≤ 5 | -1.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-carbamoyl-2-(2,2-dimethylpiperazin-1-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-carbamoyl-2-(2,2-dimethylpiperazin-1-yl)acetamide?
The IUPAC name of N-carbamoyl-2-(2,2-dimethylpiperazin-1-yl)acetamide (CID 65463600) is N-carbamoyl-2-(2,2-dimethylpiperazin-1-yl)acetamide.
What is the SMILES notation for N-carbamoyl-2-(2,2-dimethylpiperazin-1-yl)acetamide?
The canonical SMILES for N-carbamoyl-2-(2,2-dimethylpiperazin-1-yl)acetamide is CC1(C)CNCCN1CC(=O)NC(N)=O.
What is the InChIKey of N-carbamoyl-2-(2,2-dimethylpiperazin-1-yl)acetamide?
The InChIKey is DMBIJNRKGPKOGW-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18N4O2/c1-9(2)6-11-3-4-13(9)5-7(14)12-8(10)15/h11H,3-6H2,1-2H3,(H3,10,12,14,15).
What are the key properties of N-carbamoyl-2-(2,2-dimethylpiperazin-1-yl)acetamide?
N-carbamoyl-2-(2,2-dimethylpiperazin-1-yl)acetamide has a molecular weight of 214.27 g/mol, XLogP of -1.13, 2 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-carbamoyl-2-(2,2-dimethylpiperazin-1-yl)acetamide is sourced from PubChem (CID 65463600), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).