C31H42N4O5 — CID 146244879
[(1R)-1-(3-ethenylisoquinolin-6-yl)ethyl] (3S)-1-[(2S)-2-[(3-methyl-2-pent-4-enoxybutanoyl)amino]propanoyl]diazinane-3-carboxylate (PubChem CID 146244879) has the molecular formula C31H42N4O5 and a molecular weight of 550.70 g/mol. Its IUPAC name is [(1R)-1-(3-ethenylisoquinolin-6-yl)ethyl] (3S)-1-[(2S)-2-[(3-methyl-2-pent-4-enoxybutanoyl)amino]propanoyl]diazinane-3-carboxylate.
| Compound Name | [(1R)-1-(3-ethenylisoquinolin-6-yl)ethyl] (3S)-1-[(2S)-2-[(3-methyl-2-pent-4-enoxybutanoyl)amino]propanoyl]diazinane-3-carboxylate |
|---|---|
| PubChem CID | 146244879 |
| Molecular Formula | C31H42N4O5 |
| Molecular Weight | 550.70 g/mol |
| Exact Mass | 550.32 |
| IUPAC Name | [(1R)-1-(3-ethenylisoquinolin-6-yl)ethyl] (3S)-1-[(2S)-2-[(3-methyl-2-pent-4-enoxybutanoyl)amino]propanoyl]diazinane-3-carboxylate |
| SMILES | C=CCCCOC(C(=O)N[C@@H](C)C(=O)N1CCC[C@@H](C(=O)O[C@H](C)c2ccc3cnc(C=C)cc3c2)N1)C(C)C |
| InChI | InChI=1S/C31H42N4O5/c1-7-9-10-16-39-28(20(3)4)29(36)33-21(5)30(37)35-15-11-12-27(34-35)31(38)40-22(6)23-13-14-24-19-32-26(8-2)18-25(24)17-23/h7-8,13-14,17-22,27-28,34H,1-2,9-12,15-16H2,3-6H3,(H,33,36)/t21-,22+,27-,28?/m0/s1 |
| InChIKey | OPBGXWRPMJSYMH-JLSBQARASA-N |
| XLogP | 4.49 |
| TPSA | 109.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.70 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|