C19H22ClNO4S — CID 146248069
(2S)-2-(4-chlorophenyl)-1-[(4-methylsulfonyl-3,4-dihydro-2H-chromen-3-yl)amino]propan-1-ol (PubChem CID 146248069) has the molecular formula C19H22ClNO4S and a molecular weight of 395.91 g/mol. Its IUPAC name is (2S)-2-(4-chlorophenyl)-1-[(4-methylsulfonyl-3,4-dihydro-2H-chromen-3-yl)amino]propan-1-ol.
| Compound Name | (2S)-2-(4-chlorophenyl)-1-[(4-methylsulfonyl-3,4-dihydro-2H-chromen-3-yl)amino]propan-1-ol |
|---|---|
| PubChem CID | 146248069 |
| Molecular Formula | C19H22ClNO4S |
| Molecular Weight | 395.91 g/mol |
| Exact Mass | 395.10 |
| IUPAC Name | (2S)-2-(4-chlorophenyl)-1-[(4-methylsulfonyl-3,4-dihydro-2H-chromen-3-yl)amino]propan-1-ol |
| SMILES | C[C@@H](c1ccc(Cl)cc1)C(O)NC1COc2ccccc2C1S(C)(=O)=O |
| InChI | InChI=1S/C19H22ClNO4S/c1-12(13-7-9-14(20)10-8-13)19(22)21-16-11-25-17-6-4-3-5-15(17)18(16)26(2,23)24/h3-10,12,16,18-19,21-22H,11H2,1-2H3/t12-,16?,18?,19?/m0/s1 |
| InChIKey | QQHCMNXVEYHKPX-IIIFIKOXSA-N |
| XLogP | 2.90 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.91 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|