C21H24N2O2 — CID 146248658
(1R,3R)-3,12-diethyl-10-phenyl-5-oxa-6,12-diazatetracyclo[8.4.0.01,3.04,8]tetradeca-4(8),6-dien-11-one (PubChem CID 146248658) has the molecular formula C21H24N2O2 and a molecular weight of 336.44 g/mol. Its IUPAC name is (1R,3R)-3,12-diethyl-10-phenyl-5-oxa-6,12-diazatetracyclo[8.4.0.01,3.04,8]tetradeca-4(8),6-dien-11-one.
| Compound Name | (1R,3R)-3,12-diethyl-10-phenyl-5-oxa-6,12-diazatetracyclo[8.4.0.01,3.04,8]tetradeca-4(8),6-dien-11-one |
|---|---|
| PubChem CID | 146248658 |
| Molecular Formula | C21H24N2O2 |
| Molecular Weight | 336.44 g/mol |
| Exact Mass | 336.18 |
| IUPAC Name | (1R,3R)-3,12-diethyl-10-phenyl-5-oxa-6,12-diazatetracyclo[8.4.0.01,3.04,8]tetradeca-4(8),6-dien-11-one |
| SMILES | CCN1CC[C@]23C[C@@]2(CC)c2oncc2CC3(c2ccccc2)C1=O |
| InChI | InChI=1S/C21H24N2O2/c1-3-19-14-20(19)10-11-23(4-2)18(24)21(20,16-8-6-5-7-9-16)12-15-13-22-25-17(15)19/h5-9,13H,3-4,10-12,14H2,1-2H3/t19-,20-,21?/m0/s1 |
| InChIKey | UVEHQMBQJRCQAN-AHTKWCMKSA-N |
| XLogP | 3.46 |
| TPSA | 46.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.44 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |