C56H30N10O2 — CID 146248689
3-[4-[4-[5-[5-[10-(1,10-phenanthrolin-3-yl)anthracen-9-yl]pyrazin-2-yl]pyrazin-2-yl]phenyl]phenyl]pyrazino[2,3-f]quinoxaline-5,6-dione (PubChem CID 146248689) has the molecular formula C56H30N10O2 and a molecular weight of 874.92 g/mol. Its IUPAC name is 3-[4-[4-[5-[5-[10-(1,10-phenanthrolin-3-yl)anthracen-9-yl]pyrazin-2-yl]pyrazin-2-yl]phenyl]phenyl]pyrazino[2,3-f]quinoxaline-5,6-dione.
| Compound Name | 3-[4-[4-[5-[5-[10-(1,10-phenanthrolin-3-yl)anthracen-9-yl]pyrazin-2-yl]pyrazin-2-yl]phenyl]phenyl]pyrazino[2,3-f]quinoxaline-5,6-dione |
|---|---|
| PubChem CID | 146248689 |
| Molecular Formula | C56H30N10O2 |
| Molecular Weight | 874.92 g/mol |
| Exact Mass | 874.26 |
| IUPAC Name | 3-[4-[4-[5-[5-[10-(1,10-phenanthrolin-3-yl)anthracen-9-yl]pyrazin-2-yl]pyrazin-2-yl]phenyl]phenyl]pyrazino[2,3-f]quinoxaline-5,6-dione |
| SMILES | O=C1C(=O)c2nc(-c3ccc(-c4ccc(-c5cnc(-c6cnc(-c7c8ccccc8c(-c8cnc9c(ccc%10cccnc%109)c8)c8ccccc78)cn6)cn5)cc4)cc3)cnc2-c2nccnc21 |
| InChI | InChI=1S/C56H30N10O2/c67-55-53-51(58-22-23-59-53)52-54(56(55)68)66-43(27-65-52)34-17-13-32(14-18-34)31-11-15-33(16-12-31)42-26-61-44(28-60-42)45-29-63-46(30-62-45)48-40-9-3-1-7-38(40)47(39-8-2-4-10-41(39)48)37-24-36-20-19-35-6-5-21-57-49(35)50(36)64-25-37/h1-30H |
| InChIKey | BXVJQZYWROLLQG-UHFFFAOYSA-N |
| XLogP | 11.30 |
| TPSA | 163.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 68 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 874.92 |
| LogP ≤ 5 | 11.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|