C17H16N4O2S — CID 146249093
N-(3-isothiocyanatocyclobutyl)-5-(4-methoxyphenyl)pyrazine-2-carboxamide (PubChem CID 146249093) has the molecular formula C17H16N4O2S and a molecular weight of 340.41 g/mol. Its IUPAC name is N-(3-isothiocyanatocyclobutyl)-5-(4-methoxyphenyl)pyrazine-2-carboxamide.
| Compound Name | N-(3-isothiocyanatocyclobutyl)-5-(4-methoxyphenyl)pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 146249093 |
| Molecular Formula | C17H16N4O2S |
| Molecular Weight | 340.41 g/mol |
| Exact Mass | 340.10 |
| IUPAC Name | N-(3-isothiocyanatocyclobutyl)-5-(4-methoxyphenyl)pyrazine-2-carboxamide |
| SMILES | COc1ccc(-c2cnc(C(=O)NC3CC(N=C=S)C3)cn2)cc1 |
| InChI | InChI=1S/C17H16N4O2S/c1-23-14-4-2-11(3-5-14)15-8-19-16(9-18-15)17(22)21-13-6-12(7-13)20-10-24/h2-5,8-9,12-13H,6-7H2,1H3,(H,21,22) |
| InChIKey | UZIRQHSFYNCKNL-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 76.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.41 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|