C22H26N6O2 — CID 146251397
(2E,4Z)-6-[(3S)-2-[1-(4-methoxypyrimidin-2-yl)piperidine-4-carbonyl]-3,4-dihydropyrazol-3-yl]-2-methylhepta-2,4,6-trienenitrile (PubChem CID 146251397) has the molecular formula C22H26N6O2 and a molecular weight of 406.49 g/mol. Its IUPAC name is (2E,4Z)-6-[(3S)-2-[1-(4-methoxypyrimidin-2-yl)piperidine-4-carbonyl]-3,4-dihydropyrazol-3-yl]-2-methylhepta-2,4,6-trienenitrile.
| Compound Name | (2E,4Z)-6-[(3S)-2-[1-(4-methoxypyrimidin-2-yl)piperidine-4-carbonyl]-3,4-dihydropyrazol-3-yl]-2-methylhepta-2,4,6-trienenitrile |
|---|---|
| PubChem CID | 146251397 |
| Molecular Formula | C22H26N6O2 |
| Molecular Weight | 406.49 g/mol |
| Exact Mass | 406.21 |
| IUPAC Name | (2E,4Z)-6-[(3S)-2-[1-(4-methoxypyrimidin-2-yl)piperidine-4-carbonyl]-3,4-dihydropyrazol-3-yl]-2-methylhepta-2,4,6-trienenitrile |
| SMILES | C=C(/C=C\C=C(/C)C#N)[C@@H]1CC=NN1C(=O)C1CCN(c2nccc(OC)n2)CC1 |
| InChI | InChI=1S/C22H26N6O2/c1-16(15-23)5-4-6-17(2)19-7-12-25-28(19)21(29)18-9-13-27(14-10-18)22-24-11-8-20(26-22)30-3/h4-6,8,11-12,18-19H,2,7,9-10,13-14H2,1,3H3/b6-4-,16-5+/t19-/m0/s1 |
| InChIKey | ODSCUBVMBPGGKJ-KOAPGRLNSA-N |
| XLogP | 2.87 |
| TPSA | 94.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.49 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|