C20H22FN3O3 — CID 146251807
ethyl (E)-3-[4-(4-fluorophenyl)-5-oxo-6-piperidin-1-ylpyrazin-2-yl]prop-2-enoate (PubChem CID 146251807) has the molecular formula C20H22FN3O3 and a molecular weight of 371.41 g/mol. Its IUPAC name is ethyl (E)-3-[4-(4-fluorophenyl)-5-oxo-6-piperidin-1-ylpyrazin-2-yl]prop-2-enoate.
| Compound Name | ethyl (E)-3-[4-(4-fluorophenyl)-5-oxo-6-piperidin-1-ylpyrazin-2-yl]prop-2-enoate |
|---|---|
| PubChem CID | 146251807 |
| Molecular Formula | C20H22FN3O3 |
| Molecular Weight | 371.41 g/mol |
| Exact Mass | 371.16 |
| IUPAC Name | ethyl (E)-3-[4-(4-fluorophenyl)-5-oxo-6-piperidin-1-ylpyrazin-2-yl]prop-2-enoate |
| SMILES | CCOC(=O)/C=C/c1cn(-c2ccc(F)cc2)c(=O)c(N2CCCCC2)n1 |
| InChI | InChI=1S/C20H22FN3O3/c1-2-27-18(25)11-8-16-14-24(17-9-6-15(21)7-10-17)20(26)19(22-16)23-12-4-3-5-13-23/h6-11,14H,2-5,12-13H2,1H3/b11-8+ |
| InChIKey | QQRYDOAMVUDFND-DHZHZOJOSA-N |
| XLogP | 2.94 |
| TPSA | 64.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.41 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|