C19H25FN4O2S — CID 146251868
1-[(4-fluorophenyl)methyl]-5-(3-hydroxypropyl)-3-(4-methylsulfanylpiperazin-1-yl)pyrazin-2-one (PubChem CID 146251868) has the molecular formula C19H25FN4O2S and a molecular weight of 392.50 g/mol. Its IUPAC name is 1-[(4-fluorophenyl)methyl]-5-(3-hydroxypropyl)-3-(4-methylsulfanylpiperazin-1-yl)pyrazin-2-one.
| Compound Name | 1-[(4-fluorophenyl)methyl]-5-(3-hydroxypropyl)-3-(4-methylsulfanylpiperazin-1-yl)pyrazin-2-one |
|---|---|
| PubChem CID | 146251868 |
| Molecular Formula | C19H25FN4O2S |
| Molecular Weight | 392.50 g/mol |
| Exact Mass | 392.17 |
| IUPAC Name | 1-[(4-fluorophenyl)methyl]-5-(3-hydroxypropyl)-3-(4-methylsulfanylpiperazin-1-yl)pyrazin-2-one |
| SMILES | CSN1CCN(c2nc(CCCO)cn(Cc3ccc(F)cc3)c2=O)CC1 |
| InChI | InChI=1S/C19H25FN4O2S/c1-27-24-10-8-22(9-11-24)18-19(26)23(14-17(21-18)3-2-12-25)13-15-4-6-16(20)7-5-15/h4-7,14,25H,2-3,8-13H2,1H3 |
| InChIKey | YZJHJFVNHQCOTG-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 61.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.50 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|