C21H25FN4O2 — CID 146251980
3-[6-[4-(1-aminoethenyl)piperidin-1-yl]-4-[(4-fluorophenyl)methyl]-5-oxopyrazin-2-yl]propanal (PubChem CID 146251980) has the molecular formula C21H25FN4O2 and a molecular weight of 384.46 g/mol. Its IUPAC name is 3-[6-[4-(1-aminoethenyl)piperidin-1-yl]-4-[(4-fluorophenyl)methyl]-5-oxopyrazin-2-yl]propanal.
| Compound Name | 3-[6-[4-(1-aminoethenyl)piperidin-1-yl]-4-[(4-fluorophenyl)methyl]-5-oxopyrazin-2-yl]propanal |
|---|---|
| PubChem CID | 146251980 |
| Molecular Formula | C21H25FN4O2 |
| Molecular Weight | 384.46 g/mol |
| Exact Mass | 384.20 |
| IUPAC Name | 3-[6-[4-(1-aminoethenyl)piperidin-1-yl]-4-[(4-fluorophenyl)methyl]-5-oxopyrazin-2-yl]propanal |
| SMILES | C=C(N)C1CCN(c2nc(CCC=O)cn(Cc3ccc(F)cc3)c2=O)CC1 |
| InChI | InChI=1S/C21H25FN4O2/c1-15(23)17-8-10-25(11-9-17)20-21(28)26(14-19(24-20)3-2-12-27)13-16-4-6-18(22)7-5-16/h4-7,12,14,17H,1-3,8-11,13,23H2 |
| InChIKey | LMSQYLYLYSDSAJ-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 81.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.46 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|