C18H21N7OS — CID 146253383
4-(4-methoxypiperidin-1-yl)-3-methyl-11-(1H-pyrazol-5-yl)-12-thia-3,5,8-triazatricyclo[7.3.0.02,6]dodeca-1(9),2(6),4,7,10-pentaen-7-amine (PubChem CID 146253383) has the molecular formula C18H21N7OS and a molecular weight of 383.48 g/mol. Its IUPAC name is 4-(4-methoxypiperidin-1-yl)-3-methyl-11-(1H-pyrazol-5-yl)-12-thia-3,5,8-triazatricyclo[7.3.0.02,6]dodeca-1(9),2(6),4,7,10-pentaen-7-amine.
| Compound Name | 4-(4-methoxypiperidin-1-yl)-3-methyl-11-(1H-pyrazol-5-yl)-12-thia-3,5,8-triazatricyclo[7.3.0.02,6]dodeca-1(9),2(6),4,7,10-pentaen-7-amine |
|---|---|
| PubChem CID | 146253383 |
| Molecular Formula | C18H21N7OS |
| Molecular Weight | 383.48 g/mol |
| Exact Mass | 383.15 |
| IUPAC Name | 4-(4-methoxypiperidin-1-yl)-3-methyl-11-(1H-pyrazol-5-yl)-12-thia-3,5,8-triazatricyclo[7.3.0.02,6]dodeca-1(9),2(6),4,7,10-pentaen-7-amine |
| SMILES | COC1CCN(c2nc3c(N)nc4cc(-c5ccn[nH]5)sc4c3n2C)CC1 |
| InChI | InChI=1S/C18H21N7OS/c1-24-15-14(22-18(24)25-7-4-10(26-2)5-8-25)17(19)21-12-9-13(27-16(12)15)11-3-6-20-23-11/h3,6,9-10H,4-5,7-8H2,1-2H3,(H2,19,21)(H,20,23) |
| InChIKey | OLJOZCOABLJHIO-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 97.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.48 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |