C12H10N6S — CID 175945649
4-deuterio-3-methyl-11-(1H-pyrazol-5-yl)-12-thia-3,5,8-triazatricyclo[7.3.0.02,6]dodeca-1(9),2(6),4,7,10-pentaen-7-amine (PubChem CID 175945649) has the molecular formula C12H10N6S and a molecular weight of 271.33 g/mol. Its IUPAC name is 4-deuterio-3-methyl-11-(1H-pyrazol-5-yl)-12-thia-3,5,8-triazatricyclo[7.3.0.02,6]dodeca-1(9),2(6),4,7,10-pentaen-7-amine.
| Compound Name | 4-deuterio-3-methyl-11-(1H-pyrazol-5-yl)-12-thia-3,5,8-triazatricyclo[7.3.0.02,6]dodeca-1(9),2(6),4,7,10-pentaen-7-amine |
|---|---|
| PubChem CID | 175945649 |
| Molecular Formula | C12H10N6S |
| Molecular Weight | 271.33 g/mol |
| Exact Mass | 271.08 |
| IUPAC Name | 4-deuterio-3-methyl-11-(1H-pyrazol-5-yl)-12-thia-3,5,8-triazatricyclo[7.3.0.02,6]dodeca-1(9),2(6),4,7,10-pentaen-7-amine |
| SMILES | [2H]c1nc2c(N)nc3cc(-c4ccn[nH]4)sc3c2n1C |
| InChI | InChI=1S/C12H10N6S/c1-18-5-14-9-10(18)11-7(16-12(9)13)4-8(19-11)6-2-3-15-17-6/h2-5H,1H3,(H2,13,16)(H,15,17)/i5D |
| InChIKey | YOTYNDXBWUXLJS-UICOGKGYSA-N |
| XLogP | 2.16 |
| TPSA | 85.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.33 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |