C17H19N7S — CID 146253403
3-methyl-11-(1H-pyrazol-5-yl)-4-(pyrrolidin-1-ylmethyl)-12-thia-3,5,8-triazatricyclo[7.3.0.02,6]dodeca-1(9),2(6),4,7,10-pentaen-7-amine (PubChem CID 146253403) has the molecular formula C17H19N7S and a molecular weight of 353.46 g/mol. Its IUPAC name is 3-methyl-11-(1H-pyrazol-5-yl)-4-(pyrrolidin-1-ylmethyl)-12-thia-3,5,8-triazatricyclo[7.3.0.02,6]dodeca-1(9),2(6),4,7,10-pentaen-7-amine.
| Compound Name | 3-methyl-11-(1H-pyrazol-5-yl)-4-(pyrrolidin-1-ylmethyl)-12-thia-3,5,8-triazatricyclo[7.3.0.02,6]dodeca-1(9),2(6),4,7,10-pentaen-7-amine |
|---|---|
| PubChem CID | 146253403 |
| Molecular Formula | C17H19N7S |
| Molecular Weight | 353.46 g/mol |
| Exact Mass | 353.14 |
| IUPAC Name | 3-methyl-11-(1H-pyrazol-5-yl)-4-(pyrrolidin-1-ylmethyl)-12-thia-3,5,8-triazatricyclo[7.3.0.02,6]dodeca-1(9),2(6),4,7,10-pentaen-7-amine |
| SMILES | Cn1c(CN2CCCC2)nc2c(N)nc3cc(-c4ccn[nH]4)sc3c21 |
| InChI | InChI=1S/C17H19N7S/c1-23-13(9-24-6-2-3-7-24)21-14-15(23)16-11(20-17(14)18)8-12(25-16)10-4-5-19-22-10/h4-5,8H,2-3,6-7,9H2,1H3,(H2,18,20)(H,19,22) |
| InChIKey | GPGBSDLMZRSURV-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 88.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.46 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |